About 1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one
1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one (PubChem CID 22124690) has the molecular formula C22H21N5O
and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one.
Molecular Properties
| Compound Name | 1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one |
| PubChem CID | 22124690 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one |
| SMILES | O=c1ccc2cnc(Nc3ccc(-n4cccn4)cc3)cc2n1C1CCCC1 |
| InChI | InChI=1S/C22H21N5O/c28-22-11-6-16-15-23-21(14-20(16)27(22)19-4-1-2-5-19)25-17-7-9-18(10-8-17)26-13-3-12-24-26/h3,6-15,19H,1-2,4-5H2,(H,23,25) |
| InChIKey | LKGKIYRBSJTQPT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one?
The IUPAC name of 1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one (CID 22124690) is 1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one.
What is the SMILES notation for 1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one?
The canonical SMILES for 1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one is O=c1ccc2cnc(Nc3ccc(-n4cccn4)cc3)cc2n1C1CCCC1.
What is the InChIKey of 1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one?
The InChIKey is LKGKIYRBSJTQPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N5O/c28-22-11-6-16-15-23-21(14-20(16)27(22)19-4-1-2-5-19)25-17-7-9-18(10-8-17)26-13-3-12-24-26/h3,6-15,19H,1-2,4-5H2,(H,23,25).
What are the key properties of 1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one?
1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one has a molecular weight of 371.44 g/mol, XLogP of 4.44, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-7-(4-pyrazol-1-ylanilino)-1,6-naphthyridin-2-one is sourced from PubChem (CID 22124690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).