About 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one
3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one (PubChem CID 22124768) has the molecular formula C23H26Cl2N4O2
and a molecular weight of 461.39 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one.
Molecular Properties
| Compound Name | 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one |
| PubChem CID | 22124768 |
| Molecular Formula | C23H26Cl2N4O2 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one |
| SMILES | CC(CCNc1cc2c(cn1)cc(-c1c(Cl)cccc1Cl)c(=O)n2C)N1CCOCC1 |
| InChI | InChI=1S/C23H26Cl2N4O2/c1-15(29-8-10-31-11-9-29)6-7-26-21-13-20-16(14-27-21)12-17(23(30)28(20)2)22-18(24)4-3-5-19(22)25/h3-5,12-15H,6-11H2,1-2H3,(H,26,27) |
| InChIKey | IKVONXRYJZVUQV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one?
The IUPAC name of 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one (CID 22124768) is 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one.
What is the SMILES notation for 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one?
The canonical SMILES for 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one is CC(CCNc1cc2c(cn1)cc(-c1c(Cl)cccc1Cl)c(=O)n2C)N1CCOCC1.
What is the InChIKey of 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one?
The InChIKey is IKVONXRYJZVUQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26Cl2N4O2/c1-15(29-8-10-31-11-9-29)6-7-26-21-13-20-16(14-27-21)12-17(23(30)28(20)2)22-18(24)4-3-5-19(22)25/h3-5,12-15H,6-11H2,1-2H3,(H,26,27).
What are the key properties of 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one?
3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one has a molecular weight of 461.39 g/mol, XLogP of 4.43, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-one is sourced from PubChem (CID 22124768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).