C25H32ClN5O3 — CID 22124832
3-(2-chloro-3,5-dimethoxyphenyl)-1-methyl-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-one (PubChem CID 22124832) has the molecular formula C25H32ClN5O3 and a molecular weight of 486.02 g/mol. Its IUPAC name is 3-(2-chloro-3,5-dimethoxyphenyl)-1-methyl-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-one.
| Compound Name | 3-(2-chloro-3,5-dimethoxyphenyl)-1-methyl-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 22124832 |
| Molecular Formula | C25H32ClN5O3 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 3-(2-chloro-3,5-dimethoxyphenyl)-1-methyl-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-one |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(NCCCN4CCN(C)CC4)cc3n(C)c2=O)c1 |
| InChI | InChI=1S/C25H32ClN5O3/c1-29-8-10-31(11-9-29)7-5-6-27-23-15-21-17(16-28-23)12-20(25(32)30(21)2)19-13-18(33-3)14-22(34-4)24(19)26/h12-16H,5-11H2,1-4H3,(H,27,28) |
| InChIKey | LDVOLUCUGJDNRJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|