C35H27ClN6O3 — CID 22125045
2-[2-[3-[7-anilino-3-(2-chloro-6-methylphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]phenyl]ethyl]isoindole-1,3-dione (PubChem CID 22125045) has the molecular formula C35H27ClN6O3 and a molecular weight of 615.09 g/mol. Its IUPAC name is 2-[2-[3-[7-anilino-3-(2-chloro-6-methylphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]phenyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[3-[7-anilino-3-(2-chloro-6-methylphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]phenyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 22125045 |
| Molecular Formula | C35H27ClN6O3 |
| Molecular Weight | 615.09 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | 2-[2-[3-[7-anilino-3-(2-chloro-6-methylphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]phenyl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1cccc(Cl)c1N1Cc2cnc(Nc3ccccc3)nc2N(c2cccc(CCN3C(=O)c4ccccc4C3=O)c2)C1=O |
| InChI | InChI=1S/C35H27ClN6O3/c1-22-9-7-16-29(36)30(22)41-21-24-20-37-34(38-25-11-3-2-4-12-25)39-31(24)42(35(41)45)26-13-8-10-23(19-26)17-18-40-32(43)27-14-5-6-15-28(27)33(40)44/h2-16,19-20H,17-18,21H2,1H3,(H,37,38,39) |
| InChIKey | AEXBBICYIDWTIG-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.09 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|