About isoquinolin-6-ylmethanol
isoquinolin-6-ylmethanol (PubChem CID 22126247) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is isoquinolin-6-ylmethanol.
Molecular Properties
| Compound Name | isoquinolin-6-ylmethanol |
| PubChem CID | 22126247 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | isoquinolin-6-ylmethanol |
| SMILES | OCc1ccc2cnccc2c1 |
| InChI | InChI=1S/C10H9NO/c12-7-8-1-2-10-6-11-4-3-9(10)5-8/h1-6,12H,7H2 |
| InChIKey | XIRLIZNMBKEUDD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze isoquinolin-6-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinolin-6-ylmethanol?
The IUPAC name of isoquinolin-6-ylmethanol (CID 22126247) is isoquinolin-6-ylmethanol.
What is the SMILES notation for isoquinolin-6-ylmethanol?
The canonical SMILES for isoquinolin-6-ylmethanol is OCc1ccc2cnccc2c1.
What is the InChIKey of isoquinolin-6-ylmethanol?
The InChIKey is XIRLIZNMBKEUDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO/c12-7-8-1-2-10-6-11-4-3-9(10)5-8/h1-6,12H,7H2.
What are the key properties of isoquinolin-6-ylmethanol?
isoquinolin-6-ylmethanol has a molecular weight of 159.19 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinolin-6-ylmethanol is sourced from PubChem (CID 22126247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).