C20H18Cl3N5O2S — CID 2212664
4-methyl-N-[[4-methyl-5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 2212664) has the molecular formula C20H18Cl3N5O2S and a molecular weight of 498.82 g/mol. Its IUPAC name is 4-methyl-N-[[4-methyl-5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-methyl-N-[[4-methyl-5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 2212664 |
| Molecular Formula | C20H18Cl3N5O2S |
| Molecular Weight | 498.82 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | 4-methyl-N-[[4-methyl-5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCc2nnc(SCC(=O)Nc3cc(Cl)c(Cl)cc3Cl)n2C)cc1 |
| InChI | InChI=1S/C20H18Cl3N5O2S/c1-11-3-5-12(6-4-11)19(30)24-9-17-26-27-20(28(17)2)31-10-18(29)25-16-8-14(22)13(21)7-15(16)23/h3-8H,9-10H2,1-2H3,(H,24,30)(H,25,29) |
| InChIKey | ZQSCOMYPKGJXIW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.82 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|