About 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid
4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid (PubChem CID 2212684) has the molecular formula C16H11ClN2O3S
and a molecular weight of 346.80 g/mol. Its IUPAC name is 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid |
| PubChem CID | 2212684 |
| Molecular Formula | C16H11ClN2O3S |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nc(-c3ccc(Cl)cc3)cs2)cc1O |
| InChI | InChI=1S/C16H11ClN2O3S/c17-10-3-1-9(2-4-10)13-8-23-16(19-13)18-11-5-6-12(15(21)22)14(20)7-11/h1-8,20H,(H,18,19)(H,21,22) |
| InChIKey | NSPLXNBEHSXYHJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid?
The IUPAC name of 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid (CID 2212684) is 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid.
What is the SMILES notation for 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid?
The canonical SMILES for 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid is O=C(O)c1ccc(Nc2nc(-c3ccc(Cl)cc3)cs2)cc1O.
What is the InChIKey of 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid?
The InChIKey is NSPLXNBEHSXYHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2O3S/c17-10-3-1-9(2-4-10)13-8-23-16(19-13)18-11-5-6-12(15(21)22)14(20)7-11/h1-8,20H,(H,18,19)(H,21,22).
What are the key properties of 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid?
4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid has a molecular weight of 346.80 g/mol, XLogP of 4.61, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid is sourced from PubChem (CID 2212684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).