C22H22N6O3 — CID 2212688
1-[N'-(1,3-benzodioxol-5-ylmethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-phenylurea (PubChem CID 2212688) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 1-[N'-(1,3-benzodioxol-5-ylmethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-phenylurea.
| Compound Name | 1-[N'-(1,3-benzodioxol-5-ylmethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-phenylurea |
|---|---|
| PubChem CID | 2212688 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-[N'-(1,3-benzodioxol-5-ylmethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-phenylurea |
| SMILES | Cc1cc(C)nc(N/C(=N/Cc2ccc3c(c2)OCO3)NC(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C22H22N6O3/c1-14-10-15(2)25-21(24-14)27-20(28-22(29)26-17-6-4-3-5-7-17)23-12-16-8-9-18-19(11-16)31-13-30-18/h3-11H,12-13H2,1-2H3,(H3,23,24,25,26,27,28,29) |
| InChIKey | YGCYDRPZSUFGPZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|