About 3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid
3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid (PubChem CID 22127228) has the molecular formula C22H24FNO3
and a molecular weight of 369.44 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid |
| PubChem CID | 22127228 |
| Molecular Formula | C22H24FNO3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2ccc(F)cc2)C(OCc2ccc3c(c2)CCC3)C1 |
| InChI | InChI=1S/C22H24FNO3/c23-19-8-6-17(7-9-19)20-10-11-24(22(25)26)13-21(20)27-14-15-4-5-16-2-1-3-18(16)12-15/h4-9,12,20-21H,1-3,10-11,13-14H2,(H,25,26) |
| InChIKey | XZSGEEVVPTWADE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid?
The IUPAC name of 3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid (CID 22127228) is 3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid.
What is the SMILES notation for 3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid?
The canonical SMILES for 3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid is O=C(O)N1CCC(c2ccc(F)cc2)C(OCc2ccc3c(c2)CCC3)C1.
What is the InChIKey of 3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid?
The InChIKey is XZSGEEVVPTWADE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24FNO3/c23-19-8-6-17(7-9-19)20-10-11-24(22(25)26)13-21(20)27-14-15-4-5-16-2-1-3-18(16)12-15/h4-9,12,20-21H,1-3,10-11,13-14H2,(H,25,26).
What are the key properties of 3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid?
3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid has a molecular weight of 369.44 g/mol, XLogP of 4.37, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1H-inden-5-ylmethoxy)-4-(4-fluorophenyl)piperidine-1-carboxylic acid is sourced from PubChem (CID 22127228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).