About (4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate
(4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate (PubChem CID 2212727) has the molecular formula C26H22N2O5
and a molecular weight of 442.47 g/mol. Its IUPAC name is (4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate.
Molecular Properties
| Compound Name | (4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate |
| PubChem CID | 2212727 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | (4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate |
| SMILES | CC(C)OC(=O)c1ccc(COC(=O)c2cccc(-c3nnc(-c4ccccc4)o3)c2)cc1 |
| InChI | InChI=1S/C26H22N2O5/c1-17(2)32-26(30)20-13-11-18(12-14-20)16-31-25(29)22-10-6-9-21(15-22)24-28-27-23(33-24)19-7-4-3-5-8-19/h3-15,17H,16H2,1-2H3 |
| InChIKey | CFNGWFMBOLNLDZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate?
The IUPAC name of (4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate (CID 2212727) is (4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate.
What is the SMILES notation for (4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate?
The canonical SMILES for (4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate is CC(C)OC(=O)c1ccc(COC(=O)c2cccc(-c3nnc(-c4ccccc4)o3)c2)cc1.
What is the InChIKey of (4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate?
The InChIKey is CFNGWFMBOLNLDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N2O5/c1-17(2)32-26(30)20-13-11-18(12-14-20)16-31-25(29)22-10-6-9-21(15-22)24-28-27-23(33-24)19-7-4-3-5-8-19/h3-15,17H,16H2,1-2H3.
What are the key properties of (4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate?
(4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate has a molecular weight of 442.47 g/mol, XLogP of 5.33, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propan-2-yloxycarbonylphenyl)methyl 3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoate is sourced from PubChem (CID 2212727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).