C31H35NO7 — CID 22128318
3-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid (PubChem CID 22128318) has the molecular formula C31H35NO7 and a molecular weight of 533.62 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22128318 |
| Molecular Formula | C31H35NO7 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2ccc(OCCCOCc3ccccc3)cc2)C(OCc2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C31H35NO7/c33-31(34)32-14-13-27(30(20-32)39-22-24-7-12-28-29(19-24)38-18-17-37-28)25-8-10-26(11-9-25)36-16-4-15-35-21-23-5-2-1-3-6-23/h1-3,5-12,19,27,30H,4,13-18,20-22H2,(H,33,34) |
| InChIKey | RWNUDWGNNPROKR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|