C16H8F6N4O4 — CID 22129213
2-amino-5-[6-(4-amino-2,3,6-trifluoro-5-hydroxyphenoxy)pyrimidin-4-yl]oxy-3,4,6-trifluorophenol (PubChem CID 22129213) has the molecular formula C16H8F6N4O4 and a molecular weight of 434.25 g/mol. Its IUPAC name is 2-amino-5-[6-(4-amino-2,3,6-trifluoro-5-hydroxyphenoxy)pyrimidin-4-yl]oxy-3,4,6-trifluorophenol.
| Compound Name | 2-amino-5-[6-(4-amino-2,3,6-trifluoro-5-hydroxyphenoxy)pyrimidin-4-yl]oxy-3,4,6-trifluorophenol |
|---|---|
| PubChem CID | 22129213 |
| Molecular Formula | C16H8F6N4O4 |
| Molecular Weight | 434.25 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 2-amino-5-[6-(4-amino-2,3,6-trifluoro-5-hydroxyphenoxy)pyrimidin-4-yl]oxy-3,4,6-trifluorophenol |
| SMILES | Nc1c(O)c(F)c(Oc2cc(Oc3c(F)c(O)c(N)c(F)c3F)ncn2)c(F)c1F |
| InChI | InChI=1S/C16H8F6N4O4/c17-5-7(19)15(9(21)13(27)11(5)23)29-3-1-4(26-2-25-3)30-16-8(20)6(18)12(24)14(28)10(16)22/h1-2,27-28H,23-24H2 |
| InChIKey | DFOMGPGCAPEGTN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 136.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|