C4H9N5 — CID 22129274
1,4-dihydropyrimidine-2,5,6-triamine (PubChem CID 22129274) has the molecular formula C4H9N5 and a molecular weight of 127.15 g/mol. Its IUPAC name is 1,4-dihydropyrimidine-2,5,6-triamine.
| Compound Name | 1,4-dihydropyrimidine-2,5,6-triamine |
|---|---|
| PubChem CID | 22129274 |
| Molecular Formula | C4H9N5 |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.09 |
| IUPAC Name | 1,4-dihydropyrimidine-2,5,6-triamine |
| SMILES | NC1=NCC(N)=C(N)N1 |
| InChI | InChI=1S/C4H9N5/c5-2-1-8-4(7)9-3(2)6/h1,5-6H2,(H3,7,8,9) |
| InChIKey | CYSOBTICRNYDKY-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |