About 2-methylpropyl propan-2-yl carbonate
2-methylpropyl propan-2-yl carbonate (PubChem CID 22129399) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is 2-methylpropyl propan-2-yl carbonate.
Molecular Properties
| Compound Name | 2-methylpropyl propan-2-yl carbonate |
| PubChem CID | 22129399 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 2-methylpropyl propan-2-yl carbonate |
| SMILES | CC(C)COC(=O)OC(C)C |
| InChI | InChI=1S/C8H16O3/c1-6(2)5-10-8(9)11-7(3)4/h6-7H,5H2,1-4H3 |
| InChIKey | GHVXTTWHYKBHSN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropyl propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl propan-2-yl carbonate?
The IUPAC name of 2-methylpropyl propan-2-yl carbonate (CID 22129399) is 2-methylpropyl propan-2-yl carbonate.
What is the SMILES notation for 2-methylpropyl propan-2-yl carbonate?
The canonical SMILES for 2-methylpropyl propan-2-yl carbonate is CC(C)COC(=O)OC(C)C.
What is the InChIKey of 2-methylpropyl propan-2-yl carbonate?
The InChIKey is GHVXTTWHYKBHSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-6(2)5-10-8(9)11-7(3)4/h6-7H,5H2,1-4H3.
What are the key properties of 2-methylpropyl propan-2-yl carbonate?
2-methylpropyl propan-2-yl carbonate has a molecular weight of 160.21 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl propan-2-yl carbonate is sourced from PubChem (CID 22129399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).