About 2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole
2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole (PubChem CID 22130341) has the molecular formula C15H17Cl2N5
and a molecular weight of 338.24 g/mol. Its IUPAC name is 2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole.
Molecular Properties
| Compound Name | 2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole |
| PubChem CID | 22130341 |
| Molecular Formula | C15H17Cl2N5 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole |
| SMILES | CC(C)c1nc(CN=[N+]=[N-])n(C)c1Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H17Cl2N5/c1-9(2)15-13(22(3)14(20-15)8-19-21-18)6-10-4-11(16)7-12(17)5-10/h4-5,7,9H,6,8H2,1-3H3 |
| InChIKey | HXAMQITTZMNDMH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole?
The IUPAC name of 2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole (CID 22130341) is 2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole.
What is the SMILES notation for 2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole?
The canonical SMILES for 2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole is CC(C)c1nc(CN=[N+]=[N-])n(C)c1Cc1cc(Cl)cc(Cl)c1.
What is the InChIKey of 2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole?
The InChIKey is HXAMQITTZMNDMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17Cl2N5/c1-9(2)15-13(22(3)14(20-15)8-19-21-18)6-10-4-11(16)7-12(17)5-10/h4-5,7,9H,6,8H2,1-3H3.
What are the key properties of 2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole?
2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole has a molecular weight of 338.24 g/mol, XLogP of 5.25, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azidomethyl)-5-[(3,5-dichlorophenyl)methyl]-1-methyl-4-propan-2-ylimidazole is sourced from PubChem (CID 22130341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).