About 2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate
2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate (PubChem CID 22130924) has the molecular formula C23H27N3O2
and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate.
Molecular Properties
| Compound Name | 2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate |
| PubChem CID | 22130924 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate |
| SMILES | CC(C)c1nc(CCOC(N)=O)n(Cc2ccccc2)c1Cc1ccccc1 |
| InChI | InChI=1S/C23H27N3O2/c1-17(2)22-20(15-18-9-5-3-6-10-18)26(16-19-11-7-4-8-12-19)21(25-22)13-14-28-23(24)27/h3-12,17H,13-16H2,1-2H3,(H2,24,27) |
| InChIKey | AYBDDIQVCIGVSG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate?
The IUPAC name of 2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate (CID 22130924) is 2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate.
What is the SMILES notation for 2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate?
The canonical SMILES for 2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate is CC(C)c1nc(CCOC(N)=O)n(Cc2ccccc2)c1Cc1ccccc1.
What is the InChIKey of 2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate?
The InChIKey is AYBDDIQVCIGVSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O2/c1-17(2)22-20(15-18-9-5-3-6-10-18)26(16-19-11-7-4-8-12-19)21(25-22)13-14-28-23(24)27/h3-12,17H,13-16H2,1-2H3,(H2,24,27).
What are the key properties of 2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate?
2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate has a molecular weight of 377.49 g/mol, XLogP of 4.28, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,5-dibenzyl-4-propan-2-ylimidazol-2-yl)ethyl carbamate is sourced from PubChem (CID 22130924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).