About methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate
methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate (PubChem CID 22131008) has the molecular formula C18H22Cl2N2O2S
and a molecular weight of 401.36 g/mol. Its IUPAC name is methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate |
| PubChem CID | 22131008 |
| Molecular Formula | C18H22Cl2N2O2S |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate |
| SMILES | CCn1c(CCC(=O)OC)nc(C(C)C)c1Sc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H22Cl2N2O2S/c1-5-22-15(6-7-16(23)24-4)21-17(11(2)3)18(22)25-14-9-12(19)8-13(20)10-14/h8-11H,5-7H2,1-4H3 |
| InChIKey | YBOGXHSUDWXIDX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate?
The IUPAC name of methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate (CID 22131008) is methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate.
What is the SMILES notation for methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate?
The canonical SMILES for methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate is CCn1c(CCC(=O)OC)nc(C(C)C)c1Sc1cc(Cl)cc(Cl)c1.
What is the InChIKey of methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate?
The InChIKey is YBOGXHSUDWXIDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22Cl2N2O2S/c1-5-22-15(6-7-16(23)24-4)21-17(11(2)3)18(22)25-14-9-12(19)8-13(20)10-14/h8-11H,5-7H2,1-4H3.
What are the key properties of methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate?
methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate has a molecular weight of 401.36 g/mol, XLogP of 5.59, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[5-(3,5-dichlorophenyl)sulfanyl-1-ethyl-4-propan-2-ylimidazol-2-yl]propanoate is sourced from PubChem (CID 22131008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).