C14H24BrF5O2S — CID 22131092
1-bromo-9-(4,4,5,5,5-pentafluoropentylsulfonyl)nonane (PubChem CID 22131092) has the molecular formula C14H24BrF5O2S and a molecular weight of 431.31 g/mol. Its IUPAC name is 1-bromo-9-(4,4,5,5,5-pentafluoropentylsulfonyl)nonane.
| Compound Name | 1-bromo-9-(4,4,5,5,5-pentafluoropentylsulfonyl)nonane |
|---|---|
| PubChem CID | 22131092 |
| Molecular Formula | C14H24BrF5O2S |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 1-bromo-9-(4,4,5,5,5-pentafluoropentylsulfonyl)nonane |
| SMILES | O=S(=O)(CCCCCCCCCBr)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H24BrF5O2S/c15-10-6-4-2-1-3-5-7-11-23(21,22)12-8-9-13(16,17)14(18,19)20/h1-12H2 |
| InChIKey | RUNXGQRYZNXSRS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|