About 5-bromo-7-methyl-1,3-dihydroindol-2-one
5-bromo-7-methyl-1,3-dihydroindol-2-one (PubChem CID 22131105) has the molecular formula C9H8BrNO
and a molecular weight of 226.07 g/mol. Its IUPAC name is 5-bromo-7-methyl-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-bromo-7-methyl-1,3-dihydroindol-2-one |
| PubChem CID | 22131105 |
| Molecular Formula | C9H8BrNO |
| Molecular Weight | 226.07 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | 5-bromo-7-methyl-1,3-dihydroindol-2-one |
| SMILES | Cc1cc(Br)cc2c1NC(=O)C2 |
| InChI | InChI=1S/C9H8BrNO/c1-5-2-7(10)3-6-4-8(12)11-9(5)6/h2-3H,4H2,1H3,(H,11,12) |
| InChIKey | MZNDURZLKXBGAU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.07 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-7-methyl-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-7-methyl-1,3-dihydroindol-2-one?
The IUPAC name of 5-bromo-7-methyl-1,3-dihydroindol-2-one (CID 22131105) is 5-bromo-7-methyl-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-bromo-7-methyl-1,3-dihydroindol-2-one?
The canonical SMILES for 5-bromo-7-methyl-1,3-dihydroindol-2-one is Cc1cc(Br)cc2c1NC(=O)C2.
What is the InChIKey of 5-bromo-7-methyl-1,3-dihydroindol-2-one?
The InChIKey is MZNDURZLKXBGAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO/c1-5-2-7(10)3-6-4-8(12)11-9(5)6/h2-3H,4H2,1H3,(H,11,12).
What are the key properties of 5-bromo-7-methyl-1,3-dihydroindol-2-one?
5-bromo-7-methyl-1,3-dihydroindol-2-one has a molecular weight of 226.07 g/mol, XLogP of 2.25, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-7-methyl-1,3-dihydroindol-2-one is sourced from PubChem (CID 22131105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).