C18H28O2 — CID 22132053
1-(1-butoxy-2,2-dimethylpropoxy)-4-prop-1-en-2-ylbenzene (PubChem CID 22132053) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-(1-butoxy-2,2-dimethylpropoxy)-4-prop-1-en-2-ylbenzene.
| Compound Name | 1-(1-butoxy-2,2-dimethylpropoxy)-4-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 22132053 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 1-(1-butoxy-2,2-dimethylpropoxy)-4-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccc(OC(OCCCC)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28O2/c1-7-8-13-19-17(18(4,5)6)20-16-11-9-15(10-12-16)14(2)3/h9-12,17H,2,7-8,13H2,1,3-6H3 |
| InChIKey | UHTJFGYBCCYGNG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|