About 2-methyl-1-(2,2,2-trifluoroacetyl)azetidine-2-carboxylic acid
2-methyl-1-(2,2,2-trifluoroacetyl)azetidine-2-carboxylic acid (PubChem CID 22132138) has the molecular formula C7H8F3NO3
and a molecular weight of 211.14 g/mol. Its IUPAC name is 2-methyl-1-(2,2,2-trifluoroacetyl)azetidine-2-carboxylic acid.
Analyze 2-methyl-1-(2,2,2-trifluoroacetyl)azetidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(2,2,2-trifluoroacetyl)azetidine-2-carboxylic acid?
The IUPAC name of 2-methyl-1-(2,2,2-trifluoroacetyl)azetidine-2-carboxylic acid (CID 22132138) is 2-methyl-1-(2,2,2-trifluoroacetyl)azetidine-2-carboxylic acid.
What is the SMILES notation for 2-methyl-1-(2,2,2-trifluoroacetyl)azetidine-2-carboxylic acid?
The canonical SMILES for 2-methyl-1-(2,2,2-trifluoroacetyl)azetidine-2-carboxylic acid is CC1(C(=O)O)CCN1C(=O)C(F)(F)F.
What is the InChIKey of 2-methyl-1-(2,2,2-trifluoroacetyl)azetidine-2-carboxylic acid?
The InChIKey is KCXGJRHSTADJAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3NO3/c1-6(5(13)14)2-3-11(6)4(12)7(8,9)10/h2-3H2,1H3,(H,13,14).
What are the key properties of 2-methyl-1-(2,2,2-trifluoroacetyl)azetidine-2-carboxylic acid?
2-methyl-1-(2,2,2-trifluoroacetyl)azetidine-2-carboxylic acid has a molecular weight of 211.14 g/mol, XLogP of 0.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(2,2,2-trifluoroacetyl)azetidine-2-carboxylic acid is sourced from PubChem (CID 22132138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).