About 2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine
2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine (PubChem CID 22132323) has the molecular formula C10H15FN2O4
and a molecular weight of 246.24 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine.
Molecular Properties
| Compound Name | 2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine |
| PubChem CID | 22132323 |
| Molecular Formula | C10H15FN2O4 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine |
| SMILES | CCOc1nc(OCC(OC)OC)ncc1F |
| InChI | InChI=1S/C10H15FN2O4/c1-4-16-9-7(11)5-12-10(13-9)17-6-8(14-2)15-3/h5,8H,4,6H2,1-3H3 |
| InChIKey | FJKYFKBZMRPFGI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine?
The IUPAC name of 2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine (CID 22132323) is 2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine.
What is the SMILES notation for 2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine?
The canonical SMILES for 2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine is CCOc1nc(OCC(OC)OC)ncc1F.
What is the InChIKey of 2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine?
The InChIKey is FJKYFKBZMRPFGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FN2O4/c1-4-16-9-7(11)5-12-10(13-9)17-6-8(14-2)15-3/h5,8H,4,6H2,1-3H3.
What are the key properties of 2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine?
2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine has a molecular weight of 246.24 g/mol, XLogP of 1.01, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethoxyethoxy)-4-ethoxy-5-fluoropyrimidine is sourced from PubChem (CID 22132323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).