C24H25F3N2O6S — CID 22132556
[2-[4-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]butyl]-3,4-dihydro-1H-isoquinolin-7-yl] trifluoromethanesulfonate (PubChem CID 22132556) has the molecular formula C24H25F3N2O6S and a molecular weight of 526.53 g/mol. Its IUPAC name is [2-[4-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]butyl]-3,4-dihydro-1H-isoquinolin-7-yl] trifluoromethanesulfonate.
| Compound Name | [2-[4-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]butyl]-3,4-dihydro-1H-isoquinolin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22132556 |
| Molecular Formula | C24H25F3N2O6S |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | [2-[4-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]butyl]-3,4-dihydro-1H-isoquinolin-7-yl] trifluoromethanesulfonate |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)NCCCCN1CCc2ccc(OS(=O)(=O)C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C24H25F3N2O6S/c25-24(26,27)36(31,32)35-20-6-5-18-9-12-29(15-19(18)14-20)11-2-1-10-28-23(30)8-4-17-3-7-21-22(13-17)34-16-33-21/h3-8,13-14H,1-2,9-12,15-16H2,(H,28,30)/b8-4+ |
| InChIKey | FEUSSIUIPOJJOJ-XBXARRHUSA-N |
| XLogP | 3.61 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|