About 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea
1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea (PubChem CID 22132688) has the molecular formula C24H22N4O5
and a molecular weight of 446.46 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea.
Molecular Properties
| Compound Name | 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea |
| PubChem CID | 22132688 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2ccc(Oc3ncnc4cc(OC)c(OC)cc34)cc2)c1 |
| InChI | InChI=1S/C24H22N4O5/c1-30-18-6-4-5-16(11-18)28-24(29)27-15-7-9-17(10-8-15)33-23-19-12-21(31-2)22(32-3)13-20(19)25-14-26-23/h4-14H,1-3H3,(H2,27,28,29) |
| InChIKey | CVPNKMCBEZFRKU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea?
The IUPAC name of 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea (CID 22132688) is 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea.
What is the SMILES notation for 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea?
The canonical SMILES for 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea is COc1cccc(NC(=O)Nc2ccc(Oc3ncnc4cc(OC)c(OC)cc34)cc2)c1.
What is the InChIKey of 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea?
The InChIKey is CVPNKMCBEZFRKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N4O5/c1-30-18-6-4-5-16(11-18)28-24(29)27-15-7-9-17(10-8-15)33-23-19-12-21(31-2)22(32-3)13-20(19)25-14-26-23/h4-14H,1-3H3,(H2,27,28,29).
What are the key properties of 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea?
1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea has a molecular weight of 446.46 g/mol, XLogP of 5.09, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(3-methoxyphenyl)urea is sourced from PubChem (CID 22132688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).