About diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate
diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate (PubChem CID 22132842) has the molecular formula C12H12N4O6S2
and a molecular weight of 372.38 g/mol. Its IUPAC name is diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate |
| PubChem CID | 22132842 |
| Molecular Formula | C12H12N4O6S2 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1nc(Sc2ncc([N+](=O)[O-])s2)[nH]c1C(=O)OCC |
| InChI | InChI=1S/C12H12N4O6S2/c1-3-21-9(17)7-8(10(18)22-4-2)15-11(14-7)24-12-13-5-6(23-12)16(19)20/h5H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | PVYYGVGNEFVGSS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate?
The IUPAC name of diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate (CID 22132842) is diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate.
What is the SMILES notation for diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate?
The canonical SMILES for diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate is CCOC(=O)c1nc(Sc2ncc([N+](=O)[O-])s2)[nH]c1C(=O)OCC.
What is the InChIKey of diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate?
The InChIKey is PVYYGVGNEFVGSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O6S2/c1-3-21-9(17)7-8(10(18)22-4-2)15-11(14-7)24-12-13-5-6(23-12)16(19)20/h5H,3-4H2,1-2H3,(H,14,15).
What are the key properties of diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate?
diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate has a molecular weight of 372.38 g/mol, XLogP of 2.28, 7 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1H-imidazole-4,5-dicarboxylate is sourced from PubChem (CID 22132842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).