About dichlorotitanium;bis(2-methylcyclopenta-1,3-diene)
dichlorotitanium;bis(2-methylcyclopenta-1,3-diene) (PubChem CID 22133448) has the molecular formula C12H14Cl2Ti-2
and a molecular weight of 277.02 g/mol. Its IUPAC name is dichlorotitanium;bis(2-methylcyclopenta-1,3-diene).
Molecular Properties
| Compound Name | dichlorotitanium;bis(2-methylcyclopenta-1,3-diene) |
| PubChem CID | 22133448 |
| Molecular Formula | C12H14Cl2Ti-2 |
| Molecular Weight | 277.02 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | dichlorotitanium;bis(2-methylcyclopenta-1,3-diene) |
| SMILES | CC1=[C-]CC=C1.CC1=[C-]CC=C1.Cl[Ti]Cl |
| InChI | InChI=1S/2C6H7.2ClH.Ti/c2*1-6-4-2-3-5-6;;;/h2*2,4H,3H2,1H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | JZKOXAPQQJGMSF-UHFFFAOYSA-L |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.02 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlorotitanium;bis(2-methylcyclopenta-1,3-diene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotitanium;bis(2-methylcyclopenta-1,3-diene)?
The IUPAC name of dichlorotitanium;bis(2-methylcyclopenta-1,3-diene) (CID 22133448) is dichlorotitanium;bis(2-methylcyclopenta-1,3-diene).
What is the SMILES notation for dichlorotitanium;bis(2-methylcyclopenta-1,3-diene)?
The canonical SMILES for dichlorotitanium;bis(2-methylcyclopenta-1,3-diene) is CC1=[C-]CC=C1.CC1=[C-]CC=C1.Cl[Ti]Cl.
What is the InChIKey of dichlorotitanium;bis(2-methylcyclopenta-1,3-diene)?
The InChIKey is JZKOXAPQQJGMSF-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H7.2ClH.Ti/c2*1-6-4-2-3-5-6;;;/h2*2,4H,3H2,1H3;2*1H;/q2*-1;;;+2/p-2.
What are the key properties of dichlorotitanium;bis(2-methylcyclopenta-1,3-diene)?
dichlorotitanium;bis(2-methylcyclopenta-1,3-diene) has a molecular weight of 277.02 g/mol, XLogP of 4.77, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotitanium;bis(2-methylcyclopenta-1,3-diene) is sourced from PubChem (CID 22133448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).