C13H24 — CID 22133460
(5E)-4-tert-butyl-4-methylocta-1,5-diene (PubChem CID 22133460) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is (5E)-4-tert-butyl-4-methylocta-1,5-diene.
| Compound Name | (5E)-4-tert-butyl-4-methylocta-1,5-diene |
|---|---|
| PubChem CID | 22133460 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (5E)-4-tert-butyl-4-methylocta-1,5-diene |
| SMILES | C=CCC(C)(/C=C/CC)C(C)(C)C |
| InChI | InChI=1S/C13H24/c1-7-9-11-13(6,10-8-2)12(3,4)5/h8-9,11H,2,7,10H2,1,3-6H3/b11-9+ |
| InChIKey | MVCPPHHAAZYYAT-PKNBQFBNSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|