About carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene
carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene (PubChem CID 22133461) has the molecular formula C11H20Ti
and a molecular weight of 200.15 g/mol. Its IUPAC name is carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene |
| PubChem CID | 22133461 |
| Molecular Formula | C11H20Ti |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene |
| SMILES | CC1=[C-]CC(C)=C1C.[CH3-].[CH3-].[CH3-].[Ti+4] |
| InChI | InChI=1S/C8H11.3CH3.Ti/c1-6-4-5-7(2)8(6)3;;;;/h4H2,1-3H3;3*1H3;/q4*-1;+4 |
| InChIKey | GETOKHQLXOPINB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene?
The IUPAC name of carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene (CID 22133461) is carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene.
What is the SMILES notation for carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene?
The canonical SMILES for carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene is CC1=[C-]CC(C)=C1C.[CH3-].[CH3-].[CH3-].[Ti+4].
What is the InChIKey of carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene?
The InChIKey is GETOKHQLXOPINB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11.3CH3.Ti/c1-6-4-5-7(2)8(6)3;;;;/h4H2,1-3H3;3*1H3;/q4*-1;+4.
What are the key properties of carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene?
carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene has a molecular weight of 200.15 g/mol, XLogP of 3.82, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;titanium(4+);1,2,3-trimethylcyclopenta-1,3-diene is sourced from PubChem (CID 22133461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).