C19H16F3N5O — CID 22133973
1-[2-[6-amino-9-methyl-8-(2,3,5-trifluorophenyl)purin-2-yl]ethynyl]cyclopentan-1-ol (PubChem CID 22133973) has the molecular formula C19H16F3N5O and a molecular weight of 387.37 g/mol. Its IUPAC name is 1-[2-[6-amino-9-methyl-8-(2,3,5-trifluorophenyl)purin-2-yl]ethynyl]cyclopentan-1-ol.
| Compound Name | 1-[2-[6-amino-9-methyl-8-(2,3,5-trifluorophenyl)purin-2-yl]ethynyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 22133973 |
| Molecular Formula | C19H16F3N5O |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-[2-[6-amino-9-methyl-8-(2,3,5-trifluorophenyl)purin-2-yl]ethynyl]cyclopentan-1-ol |
| SMILES | Cn1c(-c2cc(F)cc(F)c2F)nc2c(N)nc(C#CC3(O)CCCC3)nc21 |
| InChI | InChI=1S/C19H16F3N5O/c1-27-17(11-8-10(20)9-12(21)14(11)22)26-15-16(23)24-13(25-18(15)27)4-7-19(28)5-2-3-6-19/h8-9,28H,2-3,5-6H2,1H3,(H2,23,24,25) |
| InChIKey | OJYWSEYHZAAQFW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|