About pyrido[2,3-d]pyrimidine-2,7-diamine
pyrido[2,3-d]pyrimidine-2,7-diamine (PubChem CID 22134678) has the molecular formula C7H7N5
and a molecular weight of 161.17 g/mol. Its IUPAC name is pyrido[2,3-d]pyrimidine-2,7-diamine.
Molecular Properties
| Compound Name | pyrido[2,3-d]pyrimidine-2,7-diamine |
| PubChem CID | 22134678 |
| Molecular Formula | C7H7N5 |
| Molecular Weight | 161.17 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | pyrido[2,3-d]pyrimidine-2,7-diamine |
| SMILES | Nc1ccc2cnc(N)nc2n1 |
| InChI | InChI=1S/C7H7N5/c8-5-2-1-4-3-10-7(9)12-6(4)11-5/h1-3H,(H4,8,9,10,11,12) |
| InChIKey | QRRCMVPZJCHBLQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyrido[2,3-d]pyrimidine-2,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[2,3-d]pyrimidine-2,7-diamine?
The IUPAC name of pyrido[2,3-d]pyrimidine-2,7-diamine (CID 22134678) is pyrido[2,3-d]pyrimidine-2,7-diamine.
What is the SMILES notation for pyrido[2,3-d]pyrimidine-2,7-diamine?
The canonical SMILES for pyrido[2,3-d]pyrimidine-2,7-diamine is Nc1ccc2cnc(N)nc2n1.
What is the InChIKey of pyrido[2,3-d]pyrimidine-2,7-diamine?
The InChIKey is QRRCMVPZJCHBLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5/c8-5-2-1-4-3-10-7(9)12-6(4)11-5/h1-3H,(H4,8,9,10,11,12).
What are the key properties of pyrido[2,3-d]pyrimidine-2,7-diamine?
pyrido[2,3-d]pyrimidine-2,7-diamine has a molecular weight of 161.17 g/mol, XLogP of 0.19, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[2,3-d]pyrimidine-2,7-diamine is sourced from PubChem (CID 22134678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).