C13H17N3O4 — CID 22134719
2,6-dimethyl-4-(4-nitrophenyl)piperazine-1-carboxylic acid (PubChem CID 22134719) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2,6-dimethyl-4-(4-nitrophenyl)piperazine-1-carboxylic acid.
| Compound Name | 2,6-dimethyl-4-(4-nitrophenyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 22134719 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2,6-dimethyl-4-(4-nitrophenyl)piperazine-1-carboxylic acid |
| SMILES | CC1CN(c2ccc([N+](=O)[O-])cc2)CC(C)N1C(=O)O |
| InChI | InChI=1S/C13H17N3O4/c1-9-7-14(8-10(2)15(9)13(17)18)11-3-5-12(6-4-11)16(19)20/h3-6,9-10H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | IXFKCLFZBJBSEC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|