C10H15FN4 — CID 22135716
5-fluoro-N-(piperidin-4-ylmethyl)pyrimidin-2-amine (PubChem CID 22135716) has the molecular formula C10H15FN4 and a molecular weight of 210.26 g/mol. Its IUPAC name is 5-fluoro-N-(piperidin-4-ylmethyl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-(piperidin-4-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 22135716 |
| Molecular Formula | C10H15FN4 |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 5-fluoro-N-(piperidin-4-ylmethyl)pyrimidin-2-amine |
| SMILES | Fc1cnc(NCC2CCNCC2)nc1 |
| InChI | InChI=1S/C10H15FN4/c11-9-6-14-10(15-7-9)13-5-8-1-3-12-4-2-8/h6-8,12H,1-5H2,(H,13,14,15) |
| InChIKey | BHVVGKNWWUCNHC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |