About N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide
N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide (PubChem CID 2213647) has the molecular formula C23H24N2O2
and a molecular weight of 360.46 g/mol. Its IUPAC name is N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide.
Molecular Properties
| Compound Name | N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide |
| PubChem CID | 2213647 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide |
| SMILES | CN(C)N(Cc1ccccc1)C(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O2/c1-24(2)25(18-19-12-6-3-7-13-19)22(26)23(27,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17,27H,18H2,1-2H3 |
| InChIKey | UCXFFJPVTKMEJG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide?
The IUPAC name of N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide (CID 2213647) is N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide.
What is the SMILES notation for N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide?
The canonical SMILES for N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide is CN(C)N(Cc1ccccc1)C(=O)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide?
The InChIKey is UCXFFJPVTKMEJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N2O2/c1-24(2)25(18-19-12-6-3-7-13-19)22(26)23(27,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17,27H,18H2,1-2H3.
What are the key properties of N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide?
N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide has a molecular weight of 360.46 g/mol, XLogP of 3.43, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide is sourced from PubChem (CID 2213647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).