About 7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide
7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide (PubChem CID 22136701) has the molecular formula C19H22N4O2
and a molecular weight of 338.41 g/mol. Its IUPAC name is 7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide.
Molecular Properties
| Compound Name | 7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide |
| PubChem CID | 22136701 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2ccc(CN3C(=O)NC(CC(C)C)C3=O)cc2c1 |
| InChI | InChI=1S/C19H22N4O2/c1-11(2)7-16-18(24)23(19(25)22-16)10-12-3-4-13-5-6-14(17(20)21)9-15(13)8-12/h3-6,8-9,11,16H,7,10H2,1-2H3,(H3,20,21)(H,22,25) |
| InChIKey | IEQNCEMWTKSHBE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide?
The IUPAC name of 7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide (CID 22136701) is 7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide.
What is the SMILES notation for 7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide?
The canonical SMILES for 7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide is [H]/N=C(\N)c1ccc2ccc(CN3C(=O)NC(CC(C)C)C3=O)cc2c1.
What is the InChIKey of 7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide?
The InChIKey is IEQNCEMWTKSHBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O2/c1-11(2)7-16-18(24)23(19(25)22-16)10-12-3-4-13-5-6-14(17(20)21)9-15(13)8-12/h3-6,8-9,11,16H,7,10H2,1-2H3,(H3,20,21)(H,22,25).
What are the key properties of 7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide?
7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide has a molecular weight of 338.41 g/mol, XLogP of 2.59, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide is sourced from PubChem (CID 22136701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).