About N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide
N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide (PubChem CID 22137536) has the molecular formula C23H27Cl2NO3
and a molecular weight of 436.38 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide.
Molecular Properties
| Compound Name | N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide |
| PubChem CID | 22137536 |
| Molecular Formula | C23H27Cl2NO3 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide |
| SMILES | CN(CC(CCOC1CCCCO1)c1ccc(Cl)c(Cl)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H27Cl2NO3/c1-26(23(27)17-7-3-2-4-8-17)16-19(18-10-11-20(24)21(25)15-18)12-14-29-22-9-5-6-13-28-22/h2-4,7-8,10-11,15,19,22H,5-6,9,12-14,16H2,1H3 |
| InChIKey | MSTUNPVUWRXVBE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide?
The IUPAC name of N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide (CID 22137536) is N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide.
What is the SMILES notation for N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide?
The canonical SMILES for N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide is CN(CC(CCOC1CCCCO1)c1ccc(Cl)c(Cl)c1)C(=O)c1ccccc1.
What is the InChIKey of N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide?
The InChIKey is MSTUNPVUWRXVBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27Cl2NO3/c1-26(23(27)17-7-3-2-4-8-17)16-19(18-10-11-20(24)21(25)15-18)12-14-29-22-9-5-6-13-28-22/h2-4,7-8,10-11,15,19,22H,5-6,9,12-14,16H2,1H3.
What are the key properties of N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide?
N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide has a molecular weight of 436.38 g/mol, XLogP of 5.78, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dichlorophenyl)-4-(oxan-2-yloxy)butyl]-N-methylbenzamide is sourced from PubChem (CID 22137536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).