About 1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone
1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone (PubChem CID 22138000) has the molecular formula C10H5F6IO
and a molecular weight of 382.04 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone |
| PubChem CID | 22138000 |
| Molecular Formula | C10H5F6IO |
| Molecular Weight | 382.04 g/mol |
| Exact Mass | 381.93 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone |
| SMILES | O=C(CI)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H5F6IO/c11-9(12,13)6-1-5(8(18)4-17)2-7(3-6)10(14,15)16/h1-3H,4H2 |
| InChIKey | PTMQDVBLGHZQJB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.04 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone (CID 22138000) is 1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone is O=C(CI)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone?
The InChIKey is PTMQDVBLGHZQJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F6IO/c11-9(12,13)6-1-5(8(18)4-17)2-7(3-6)10(14,15)16/h1-3H,4H2.
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone?
1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone has a molecular weight of 382.04 g/mol, XLogP of 4.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]-2-iodoethanone is sourced from PubChem (CID 22138000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).