C9H12N6O — CID 22138289
phenol;1,3,5-triazine-2,4,6-triamine (PubChem CID 22138289) has the molecular formula C9H12N6O and a molecular weight of 220.24 g/mol. Its IUPAC name is phenol;1,3,5-triazine-2,4,6-triamine.
| Compound Name | phenol;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 22138289 |
| Molecular Formula | C9H12N6O |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | phenol;1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(N)n1.Oc1ccccc1 |
| InChI | InChI=1S/C6H6O.C3H6N6/c7-6-4-2-1-3-5-6;4-1-7-2(5)9-3(6)8-1/h1-5,7H;(H6,4,5,6,7,8,9) |
| InChIKey | JYIZNFVTKLARKT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 136.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |