About 2,4-dihydrotriazine-1,3,5-triamine
2,4-dihydrotriazine-1,3,5-triamine (PubChem CID 22138291) has the molecular formula C3H10N6
and a molecular weight of 130.16 g/mol. Its IUPAC name is 2,4-dihydrotriazine-1,3,5-triamine.
Molecular Properties
| Compound Name | 2,4-dihydrotriazine-1,3,5-triamine |
| PubChem CID | 22138291 |
| Molecular Formula | C3H10N6 |
| Molecular Weight | 130.16 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 2,4-dihydrotriazine-1,3,5-triamine |
| SMILES | NC1=CN(N)NN(N)C1 |
| InChI | InChI=1S/C3H10N6/c4-3-1-8(5)7-9(6)2-3/h1,7H,2,4-6H2 |
| InChIKey | BVRQCNITMAKOKX-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.16 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dihydrotriazine-1,3,5-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydrotriazine-1,3,5-triamine?
The IUPAC name of 2,4-dihydrotriazine-1,3,5-triamine (CID 22138291) is 2,4-dihydrotriazine-1,3,5-triamine.
What is the SMILES notation for 2,4-dihydrotriazine-1,3,5-triamine?
The canonical SMILES for 2,4-dihydrotriazine-1,3,5-triamine is NC1=CN(N)NN(N)C1.
What is the InChIKey of 2,4-dihydrotriazine-1,3,5-triamine?
The InChIKey is BVRQCNITMAKOKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N6/c4-3-1-8(5)7-9(6)2-3/h1,7H,2,4-6H2.
What are the key properties of 2,4-dihydrotriazine-1,3,5-triamine?
2,4-dihydrotriazine-1,3,5-triamine has a molecular weight of 130.16 g/mol, XLogP of -2.43, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydrotriazine-1,3,5-triamine is sourced from PubChem (CID 22138291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).