About 1,10-phenanthroline-4,7-diamine
1,10-phenanthroline-4,7-diamine (PubChem CID 22138387) has the molecular formula C12H10N4
and a molecular weight of 210.24 g/mol. Its IUPAC name is 1,10-phenanthroline-4,7-diamine.
Molecular Properties
| Compound Name | 1,10-phenanthroline-4,7-diamine |
| PubChem CID | 22138387 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1,10-phenanthroline-4,7-diamine |
| SMILES | Nc1ccnc2c1ccc1c(N)ccnc12 |
| InChI | InChI=1S/C12H10N4/c13-9-3-5-15-11-7(9)1-2-8-10(14)4-6-16-12(8)11/h1-6H,(H2,13,15)(H2,14,16) |
| InChIKey | POALUWHJFRTBJA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,10-phenanthroline-4,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,10-phenanthroline-4,7-diamine?
The IUPAC name of 1,10-phenanthroline-4,7-diamine (CID 22138387) is 1,10-phenanthroline-4,7-diamine.
What is the SMILES notation for 1,10-phenanthroline-4,7-diamine?
The canonical SMILES for 1,10-phenanthroline-4,7-diamine is Nc1ccnc2c1ccc1c(N)ccnc12.
What is the InChIKey of 1,10-phenanthroline-4,7-diamine?
The InChIKey is POALUWHJFRTBJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4/c13-9-3-5-15-11-7(9)1-2-8-10(14)4-6-16-12(8)11/h1-6H,(H2,13,15)(H2,14,16).
What are the key properties of 1,10-phenanthroline-4,7-diamine?
1,10-phenanthroline-4,7-diamine has a molecular weight of 210.24 g/mol, XLogP of 1.95, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,10-phenanthroline-4,7-diamine is sourced from PubChem (CID 22138387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).