C8H17N2O4S- — CID 22138409
2-[2-(1-hydroxyethyl)piperazin-1-yl]ethanesulfonate (PubChem CID 22138409) has the molecular formula C8H17N2O4S- and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-[2-(1-hydroxyethyl)piperazin-1-yl]ethanesulfonate.
| Compound Name | 2-[2-(1-hydroxyethyl)piperazin-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 22138409 |
| Molecular Formula | C8H17N2O4S- |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-[2-(1-hydroxyethyl)piperazin-1-yl]ethanesulfonate |
| SMILES | CC(O)C1CNCCN1CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H18N2O4S/c1-7(11)8-6-9-2-3-10(8)4-5-15(12,13)14/h7-9,11H,2-6H2,1H3,(H,12,13,14)/p-1 |
| InChIKey | URKWZKVFCSGYMB-UHFFFAOYSA-M |
| XLogP | -1.81 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|