About bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+)
bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+) (PubChem CID 22138507) has the molecular formula C14H18Ru
and a molecular weight of 287.37 g/mol. Its IUPAC name is bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+).
Molecular Properties
| Compound Name | bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+) |
| PubChem CID | 22138507 |
| Molecular Formula | C14H18Ru |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+) |
| SMILES | CCC1=[C-]CC=C1.CCC1=[C-]CC=C1.[Ru+2] |
| InChI | InChI=1S/2C7H9.Ru/c2*1-2-7-5-3-4-6-7;/h2*3,5H,2,4H2,1H3;/q2*-1;+2 |
| InChIKey | XUZWCRWRRXUMJF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+)?
The IUPAC name of bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+) (CID 22138507) is bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+).
What is the SMILES notation for bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+)?
The canonical SMILES for bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+) is CCC1=[C-]CC=C1.CCC1=[C-]CC=C1.[Ru+2].
What is the InChIKey of bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+)?
The InChIKey is XUZWCRWRRXUMJF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H9.Ru/c2*1-2-7-5-3-4-6-7;/h2*3,5H,2,4H2,1H3;/q2*-1;+2.
What are the key properties of bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+)?
bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+) has a molecular weight of 287.37 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethylcyclopenta-1,3-diene);ruthenium(2+) is sourced from PubChem (CID 22138507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).