About 4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine
4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine (PubChem CID 22138735) has the molecular formula C23H48ClN
and a molecular weight of 374.10 g/mol. Its IUPAC name is 4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine.
Molecular Properties
| Compound Name | 4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine |
| PubChem CID | 22138735 |
| Molecular Formula | C23H48ClN |
| Molecular Weight | 374.10 g/mol |
| Exact Mass | 373.35 |
| IUPAC Name | 4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine |
| SMILES | CCCCCCCCCCCCCCC(CCCCl)CCCN(C)C |
| InChI | InChI=1S/C23H48ClN/c1-4-5-6-7-8-9-10-11-12-13-14-15-18-23(19-16-21-24)20-17-22-25(2)3/h23H,4-22H2,1-3H3 |
| InChIKey | PZRHWMVFFFOBNA-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.10 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine?
The IUPAC name of 4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine (CID 22138735) is 4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine.
What is the SMILES notation for 4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine?
The canonical SMILES for 4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine is CCCCCCCCCCCCCCC(CCCCl)CCCN(C)C.
What is the InChIKey of 4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine?
The InChIKey is PZRHWMVFFFOBNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H48ClN/c1-4-5-6-7-8-9-10-11-12-13-14-15-18-23(19-16-21-24)20-17-22-25(2)3/h23H,4-22H2,1-3H3.
What are the key properties of 4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine?
4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine has a molecular weight of 374.10 g/mol, XLogP of 8.05, 20 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloropropyl)-N,N-dimethyloctadecan-1-amine is sourced from PubChem (CID 22138735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).