About 2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol
2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol (PubChem CID 22139214) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol.
Molecular Properties
| Compound Name | 2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol |
| PubChem CID | 22139214 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol |
| SMILES | OCCOc1ccc2cc[nH]c2n1 |
| InChI | InChI=1S/C9H10N2O2/c12-5-6-13-8-2-1-7-3-4-10-9(7)11-8/h1-4,12H,5-6H2,(H,10,11) |
| InChIKey | LCKIXCTWTNCEMJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol?
The IUPAC name of 2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol (CID 22139214) is 2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol.
What is the SMILES notation for 2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol?
The canonical SMILES for 2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol is OCCOc1ccc2cc[nH]c2n1.
What is the InChIKey of 2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol?
The InChIKey is LCKIXCTWTNCEMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c12-5-6-13-8-2-1-7-3-4-10-9(7)11-8/h1-4,12H,5-6H2,(H,10,11).
What are the key properties of 2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol?
2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol has a molecular weight of 178.19 g/mol, XLogP of 0.93, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrrolo[2,3-b]pyridin-6-yloxy)ethanol is sourced from PubChem (CID 22139214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).