About 4-chloro-[1,3]dioxolo[4,5-g]cinnoline
4-chloro-[1,3]dioxolo[4,5-g]cinnoline (PubChem CID 22139485) has the molecular formula C9H5ClN2O2
and a molecular weight of 208.60 g/mol. Its IUPAC name is 4-chloro-[1,3]dioxolo[4,5-g]cinnoline.
Molecular Properties
| Compound Name | 4-chloro-[1,3]dioxolo[4,5-g]cinnoline |
| PubChem CID | 22139485 |
| Molecular Formula | C9H5ClN2O2 |
| Molecular Weight | 208.60 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | 4-chloro-[1,3]dioxolo[4,5-g]cinnoline |
| SMILES | Clc1cnnc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C9H5ClN2O2/c10-6-3-11-12-7-2-9-8(1-5(6)7)13-4-14-9/h1-3H,4H2 |
| InChIKey | VPQMWSVKDUFHTK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.60 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-[1,3]dioxolo[4,5-g]cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-[1,3]dioxolo[4,5-g]cinnoline?
The IUPAC name of 4-chloro-[1,3]dioxolo[4,5-g]cinnoline (CID 22139485) is 4-chloro-[1,3]dioxolo[4,5-g]cinnoline.
What is the SMILES notation for 4-chloro-[1,3]dioxolo[4,5-g]cinnoline?
The canonical SMILES for 4-chloro-[1,3]dioxolo[4,5-g]cinnoline is Clc1cnnc2cc3c(cc12)OCO3.
What is the InChIKey of 4-chloro-[1,3]dioxolo[4,5-g]cinnoline?
The InChIKey is VPQMWSVKDUFHTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClN2O2/c10-6-3-11-12-7-2-9-8(1-5(6)7)13-4-14-9/h1-3H,4H2.
What are the key properties of 4-chloro-[1,3]dioxolo[4,5-g]cinnoline?
4-chloro-[1,3]dioxolo[4,5-g]cinnoline has a molecular weight of 208.60 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-[1,3]dioxolo[4,5-g]cinnoline is sourced from PubChem (CID 22139485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).