About N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide
N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide (PubChem CID 22139637) has the molecular formula C8H15N2S+
and a molecular weight of 171.29 g/mol. Its IUPAC name is N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide.
Molecular Properties
| Compound Name | N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide |
| PubChem CID | 22139637 |
| Molecular Formula | C8H15N2S+ |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide |
| SMILES | CC(=S)N[N+]1(C)C=CCCC1 |
| InChI | InChI=1S/C8H14N2S/c1-8(11)9-10(2)6-4-3-5-7-10/h4,6H,3,5,7H2,1-2H3/p+1 |
| InChIKey | KYWWYHQTCNUQRW-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide?
The IUPAC name of N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide (CID 22139637) is N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide.
What is the SMILES notation for N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide?
The canonical SMILES for N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide is CC(=S)N[N+]1(C)C=CCCC1.
What is the InChIKey of N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide?
The InChIKey is KYWWYHQTCNUQRW-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H14N2S/c1-8(11)9-10(2)6-4-3-5-7-10/h4,6H,3,5,7H2,1-2H3/p+1.
What are the key properties of N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide?
N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide has a molecular weight of 171.29 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-methyl-3,4-dihydro-2H-pyridin-1-ium-1-yl)ethanethioamide is sourced from PubChem (CID 22139637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).