About 7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene
7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene (PubChem CID 22140479) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene |
| PubChem CID | 22140479 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene |
| SMILES | COCC1(COC)C=CC=CC=C1 |
| InChI | InChI=1S/C11H16O2/c1-12-9-11(10-13-2)7-5-3-4-6-8-11/h3-8H,9-10H2,1-2H3 |
| InChIKey | ZVZZZVGNDBKCQC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene?
The IUPAC name of 7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene (CID 22140479) is 7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene.
What is the SMILES notation for 7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene?
The canonical SMILES for 7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene is COCC1(COC)C=CC=CC=C1.
What is the InChIKey of 7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene?
The InChIKey is ZVZZZVGNDBKCQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-12-9-11(10-13-2)7-5-3-4-6-8-11/h3-8H,9-10H2,1-2H3.
What are the key properties of 7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene?
7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene has a molecular weight of 180.25 g/mol, XLogP of 1.95, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-bis(methoxymethyl)cyclohepta-1,3,5-triene is sourced from PubChem (CID 22140479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).