C13H12F4O2 — CID 22140493
2,3,6,7-tetrafluoro-1,1-bis(methoxymethyl)indene (PubChem CID 22140493) has the molecular formula C13H12F4O2 and a molecular weight of 276.23 g/mol. Its IUPAC name is 2,3,6,7-tetrafluoro-1,1-bis(methoxymethyl)indene.
| Compound Name | 2,3,6,7-tetrafluoro-1,1-bis(methoxymethyl)indene |
|---|---|
| PubChem CID | 22140493 |
| Molecular Formula | C13H12F4O2 |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2,3,6,7-tetrafluoro-1,1-bis(methoxymethyl)indene |
| SMILES | COCC1(COC)C(F)=C(F)c2ccc(F)c(F)c21 |
| InChI | InChI=1S/C13H12F4O2/c1-18-5-13(6-19-2)9-7(10(15)12(13)17)3-4-8(14)11(9)16/h3-4H,5-6H2,1-2H3 |
| InChIKey | OONQZFJQVHEJFR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |