C13H20O2 — CID 22140499
1,1-bis(methoxymethyl)-4,5,6,7-tetrahydroindene (PubChem CID 22140499) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1,1-bis(methoxymethyl)-4,5,6,7-tetrahydroindene.
| Compound Name | 1,1-bis(methoxymethyl)-4,5,6,7-tetrahydroindene |
|---|---|
| PubChem CID | 22140499 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1,1-bis(methoxymethyl)-4,5,6,7-tetrahydroindene |
| SMILES | COCC1(COC)C=CC2=C1CCCC2 |
| InChI | InChI=1S/C13H20O2/c1-14-9-13(10-15-2)8-7-11-5-3-4-6-12(11)13/h7-8H,3-6,9-10H2,1-2H3 |
| InChIKey | ZKXOLTKRGCQGJN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |