C15H14F6 — CID 22140571
2-(2-cyclohexa-1,5-dien-1-yl-1,1,1,3,3,3-hexafluoropropan-2-yl)cyclohexa-1,3-diene (PubChem CID 22140571) has the molecular formula C15H14F6 and a molecular weight of 308.27 g/mol. Its IUPAC name is 2-(2-cyclohexa-1,5-dien-1-yl-1,1,1,3,3,3-hexafluoropropan-2-yl)cyclohexa-1,3-diene.
| Compound Name | 2-(2-cyclohexa-1,5-dien-1-yl-1,1,1,3,3,3-hexafluoropropan-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 22140571 |
| Molecular Formula | C15H14F6 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-(2-cyclohexa-1,5-dien-1-yl-1,1,1,3,3,3-hexafluoropropan-2-yl)cyclohexa-1,3-diene |
| SMILES | FC(F)(F)C(C1=CCCC=C1)(C1=CCCC=C1)C(F)(F)F |
| InChI | InChI=1S/C15H14F6/c16-14(17,18)13(15(19,20)21,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h3,5,7-10H,1-2,4,6H2 |
| InChIKey | SORZPJBQNIRQNW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |