About 2-methylpropanamide;dihydrochloride
2-methylpropanamide;dihydrochloride (PubChem CID 22142056) has the molecular formula C4H11Cl2NO
and a molecular weight of 160.04 g/mol. Its IUPAC name is 2-methylpropanamide;dihydrochloride.
Molecular Properties
| Compound Name | 2-methylpropanamide;dihydrochloride |
| PubChem CID | 22142056 |
| Molecular Formula | C4H11Cl2NO |
| Molecular Weight | 160.04 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | 2-methylpropanamide;dihydrochloride |
| SMILES | CC(C)C(N)=O.Cl.Cl |
| InChI | InChI=1S/C4H9NO.2ClH/c1-3(2)4(5)6;;/h3H,1-2H3,(H2,5,6);2*1H |
| InChIKey | PQSQBXGSIRXRFL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.04 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpropanamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanamide;dihydrochloride?
The IUPAC name of 2-methylpropanamide;dihydrochloride (CID 22142056) is 2-methylpropanamide;dihydrochloride.
What is the SMILES notation for 2-methylpropanamide;dihydrochloride?
The canonical SMILES for 2-methylpropanamide;dihydrochloride is CC(C)C(N)=O.Cl.Cl.
What is the InChIKey of 2-methylpropanamide;dihydrochloride?
The InChIKey is PQSQBXGSIRXRFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.2ClH/c1-3(2)4(5)6;;/h3H,1-2H3,(H2,5,6);2*1H.
What are the key properties of 2-methylpropanamide;dihydrochloride?
2-methylpropanamide;dihydrochloride has a molecular weight of 160.04 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanamide;dihydrochloride is sourced from PubChem (CID 22142056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).